C14H11ClN2O4 — CID 3362952
[2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 2-hydroxybenzoate (PubChem CID 3362952) has the molecular formula C14H11ClN2O4 and a molecular weight of 306.70 g/mol. Its IUPAC name is [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 2-hydroxybenzoate.
| Compound Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 2-hydroxybenzoate |
|---|---|
| PubChem CID | 3362952 |
| Molecular Formula | C14H11ClN2O4 |
| Molecular Weight | 306.70 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 2-hydroxybenzoate |
| SMILES | O=C(COC(=O)c1ccccc1O)Nc1cccnc1Cl |
| InChI | InChI=1S/C14H11ClN2O4/c15-13-10(5-3-7-16-13)17-12(19)8-21-14(20)9-4-1-2-6-11(9)18/h1-7,18H,8H2,(H,17,19) |
| InChIKey | AVJZMORKZREISD-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.70 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|