C13H12ClN3O3 — CID 2629282
[2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 1-methylpyrrole-2-carboxylate (PubChem CID 2629282) has the molecular formula C13H12ClN3O3 and a molecular weight of 293.71 g/mol. Its IUPAC name is [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 1-methylpyrrole-2-carboxylate.
| Compound Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 1-methylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 2629282 |
| Molecular Formula | C13H12ClN3O3 |
| Molecular Weight | 293.71 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 1-methylpyrrole-2-carboxylate |
| SMILES | Cn1cccc1C(=O)OCC(=O)Nc1cccnc1Cl |
| InChI | InChI=1S/C13H12ClN3O3/c1-17-7-3-5-10(17)13(19)20-8-11(18)16-9-4-2-6-15-12(9)14/h2-7H,8H2,1H3,(H,16,18) |
| InChIKey | DOIHKYZOUBNEPZ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.71 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|