C18H19ClN2O4 — CID 2585299
[2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 4-butoxybenzoate (PubChem CID 2585299) has the molecular formula C18H19ClN2O4 and a molecular weight of 362.81 g/mol. Its IUPAC name is [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 4-butoxybenzoate.
| Compound Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 4-butoxybenzoate |
|---|---|
| PubChem CID | 2585299 |
| Molecular Formula | C18H19ClN2O4 |
| Molecular Weight | 362.81 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 4-butoxybenzoate |
| SMILES | CCCCOc1ccc(C(=O)OCC(=O)Nc2cccnc2Cl)cc1 |
| InChI | InChI=1S/C18H19ClN2O4/c1-2-3-11-24-14-8-6-13(7-9-14)18(23)25-12-16(22)21-15-5-4-10-20-17(15)19/h4-10H,2-3,11-12H2,1H3,(H,21,22) |
| InChIKey | RWZMAEIGVGBUTR-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.81 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|