C23H26ClN3O5 — CID 55308644
[2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 4-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethoxy]benzoate (PubChem CID 55308644) has the molecular formula C23H26ClN3O5 and a molecular weight of 459.93 g/mol. Its IUPAC name is [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 4-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethoxy]benzoate.
| Compound Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 4-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethoxy]benzoate |
|---|---|
| PubChem CID | 55308644 |
| Molecular Formula | C23H26ClN3O5 |
| Molecular Weight | 459.93 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 4-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethoxy]benzoate |
| SMILES | CC1CCCC(C)N1C(=O)COc1ccc(C(=O)OCC(=O)Nc2cccnc2Cl)cc1 |
| InChI | InChI=1S/C23H26ClN3O5/c1-15-5-3-6-16(2)27(15)21(29)14-31-18-10-8-17(9-11-18)23(30)32-13-20(28)26-19-7-4-12-25-22(19)24/h4,7-12,15-16H,3,5-6,13-14H2,1-2H3,(H,26,28) |
| InChIKey | DWNIAPXQGJYTJD-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.93 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|