methyl 2-[[2-(4-propoxybenzoyl)oxyacetyl]amino]benzoate

C20H21NO6 — CID 7211925

IUPACmethyl 2-[[2-(4-propoxybenzoyl)oxyacetyl]amino]benzoate
SMILESCCCOc1ccc(C(=O)OCC(=O)Nc2ccccc2C(=O)OC)cc1
InChIInChI=1S/C20H21NO6/c1-3-12-26-15-10-8-14(9-11-15)19(23)27-13-18(22)21-17-7-5-4-6-16(17)20(24)25-2/h4-11H,3,12-13H2,1-2H3,(H,21,22)
InChIKeyBTJVHRUOJPYEBQ-UHFFFAOYSA-N
MW371.39 g/mol
LogP3.06
Rot. Bonds8

About methyl 2-[[2-(4-propoxybenzoyl)oxyacetyl]amino]benzoate

methyl 2-[[2-(4-propoxybenzoyl)oxyacetyl]amino]benzoate (PubChem CID 7211925) has the molecular formula C20H21NO6 and a molecular weight of 371.39 g/mol. Its IUPAC name is methyl 2-[[2-(4-propoxybenzoyl)oxyacetyl]amino]benzoate.

Molecular Properties

Compound Namemethyl 2-[[2-(4-propoxybenzoyl)oxyacetyl]amino]benzoate
PubChem CID7211925
Molecular FormulaC20H21NO6
Molecular Weight371.39 g/mol
Exact Mass371.14
IUPAC Namemethyl 2-[[2-(4-propoxybenzoyl)oxyacetyl]amino]benzoate
SMILESCCCOc1ccc(C(=O)OCC(=O)Nc2ccccc2C(=O)OC)cc1
InChIInChI=1S/C20H21NO6/c1-3-12-26-15-10-8-14(9-11-15)19(23)27-13-18(22)21-17-7-5-4-6-16(17)20(24)25-2/h4-11H,3,12-13H2,1-2H3,(H,21,22)
InChIKeyBTJVHRUOJPYEBQ-UHFFFAOYSA-N
XLogP3.06
TPSA90.93 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds8
Heavy Atoms27
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500371.39
LogP ≤ 53.06
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze methyl 2-[[2-(4-propoxybenzoyl)oxyacetyl]amino]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[[2-(4-propoxybenzoyl)oxyacetyl]amino]benzoate?
The IUPAC name of methyl 2-[[2-(4-propoxybenzoyl)oxyacetyl]amino]benzoate (CID 7211925) is methyl 2-[[2-(4-propoxybenzoyl)oxyacetyl]amino]benzoate.
What is the SMILES notation for methyl 2-[[2-(4-propoxybenzoyl)oxyacetyl]amino]benzoate?
The canonical SMILES for methyl 2-[[2-(4-propoxybenzoyl)oxyacetyl]amino]benzoate is CCCOc1ccc(C(=O)OCC(=O)Nc2ccccc2C(=O)OC)cc1.
What is the InChIKey of methyl 2-[[2-(4-propoxybenzoyl)oxyacetyl]amino]benzoate?
The InChIKey is BTJVHRUOJPYEBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21NO6/c1-3-12-26-15-10-8-14(9-11-15)19(23)27-13-18(22)21-17-7-5-4-6-16(17)20(24)25-2/h4-11H,3,12-13H2,1-2H3,(H,21,22).
What are the key properties of methyl 2-[[2-(4-propoxybenzoyl)oxyacetyl]amino]benzoate?
methyl 2-[[2-(4-propoxybenzoyl)oxyacetyl]amino]benzoate has a molecular weight of 371.39 g/mol, XLogP of 3.06, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[2-(4-propoxybenzoyl)oxyacetyl]amino]benzoate is sourced from PubChem (CID 7211925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).