C18H17NO7S — CID 2668483
methyl 2-[[2-(4-methylsulfonylbenzoyl)oxyacetyl]amino]benzoate (PubChem CID 2668483) has the molecular formula C18H17NO7S and a molecular weight of 391.40 g/mol. Its IUPAC name is methyl 2-[[2-(4-methylsulfonylbenzoyl)oxyacetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-(4-methylsulfonylbenzoyl)oxyacetyl]amino]benzoate |
|---|---|
| PubChem CID | 2668483 |
| Molecular Formula | C18H17NO7S |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | methyl 2-[[2-(4-methylsulfonylbenzoyl)oxyacetyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)COC(=O)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C18H17NO7S/c1-25-18(22)14-5-3-4-6-15(14)19-16(20)11-26-17(21)12-7-9-13(10-8-12)27(2,23)24/h3-10H,11H2,1-2H3,(H,19,20) |
| InChIKey | CBXUMCKJYKCXQG-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |