C17H14ClNO5 — CID 2629462
methyl 2-[[2-(4-chlorobenzoyl)oxyacetyl]amino]benzoate (PubChem CID 2629462) has the molecular formula C17H14ClNO5 and a molecular weight of 347.75 g/mol. Its IUPAC name is methyl 2-[[2-(4-chlorobenzoyl)oxyacetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-(4-chlorobenzoyl)oxyacetyl]amino]benzoate |
|---|---|
| PubChem CID | 2629462 |
| Molecular Formula | C17H14ClNO5 |
| Molecular Weight | 347.75 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | methyl 2-[[2-(4-chlorobenzoyl)oxyacetyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)COC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H14ClNO5/c1-23-17(22)13-4-2-3-5-14(13)19-15(20)10-24-16(21)11-6-8-12(18)9-7-11/h2-9H,10H2,1H3,(H,19,20) |
| InChIKey | BNYKFMIYPRIBEH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.75 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |