C20H20ClNO6 — CID 7951075
methyl 2-[[2-[2-(4-chlorophenoxy)-2-methylpropanoyl]oxyacetyl]amino]benzoate (PubChem CID 7951075) has the molecular formula C20H20ClNO6 and a molecular weight of 405.83 g/mol. Its IUPAC name is methyl 2-[[2-[2-(4-chlorophenoxy)-2-methylpropanoyl]oxyacetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-[2-(4-chlorophenoxy)-2-methylpropanoyl]oxyacetyl]amino]benzoate |
|---|---|
| PubChem CID | 7951075 |
| Molecular Formula | C20H20ClNO6 |
| Molecular Weight | 405.83 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | methyl 2-[[2-[2-(4-chlorophenoxy)-2-methylpropanoyl]oxyacetyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)COC(=O)C(C)(C)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H20ClNO6/c1-20(2,28-14-10-8-13(21)9-11-14)19(25)27-12-17(23)22-16-7-5-4-6-15(16)18(24)26-3/h4-11H,12H2,1-3H3,(H,22,23) |
| InChIKey | WIQLMQMTQSKJOO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.83 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |