C17H12Cl2FNO5 — CID 8649189
[2-(2-methoxycarbonylanilino)-2-oxoethyl] 2,4-dichloro-5-fluorobenzoate (PubChem CID 8649189) has the molecular formula C17H12Cl2FNO5 and a molecular weight of 400.19 g/mol. Its IUPAC name is [2-(2-methoxycarbonylanilino)-2-oxoethyl] 2,4-dichloro-5-fluorobenzoate.
| Compound Name | [2-(2-methoxycarbonylanilino)-2-oxoethyl] 2,4-dichloro-5-fluorobenzoate |
|---|---|
| PubChem CID | 8649189 |
| Molecular Formula | C17H12Cl2FNO5 |
| Molecular Weight | 400.19 g/mol |
| Exact Mass | 399.01 |
| IUPAC Name | [2-(2-methoxycarbonylanilino)-2-oxoethyl] 2,4-dichloro-5-fluorobenzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)COC(=O)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C17H12Cl2FNO5/c1-25-16(23)9-4-2-3-5-14(9)21-15(22)8-26-17(24)10-6-13(20)12(19)7-11(10)18/h2-7H,8H2,1H3,(H,21,22) |
| InChIKey | SVLIZXHYMKJXTD-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.19 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|