C16H9ClF2N2O3 — CID 7382609
[2-(2-cyanoanilino)-2-oxoethyl] 2-chloro-4,5-difluorobenzoate (PubChem CID 7382609) has the molecular formula C16H9ClF2N2O3 and a molecular weight of 350.71 g/mol. Its IUPAC name is [2-(2-cyanoanilino)-2-oxoethyl] 2-chloro-4,5-difluorobenzoate.
| Compound Name | [2-(2-cyanoanilino)-2-oxoethyl] 2-chloro-4,5-difluorobenzoate |
|---|---|
| PubChem CID | 7382609 |
| Molecular Formula | C16H9ClF2N2O3 |
| Molecular Weight | 350.71 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | [2-(2-cyanoanilino)-2-oxoethyl] 2-chloro-4,5-difluorobenzoate |
| SMILES | N#Cc1ccccc1NC(=O)COC(=O)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C16H9ClF2N2O3/c17-11-6-13(19)12(18)5-10(11)16(23)24-8-15(22)21-14-4-2-1-3-9(14)7-20/h1-6H,8H2,(H,21,22) |
| InChIKey | WQTRILNIYONPRG-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.71 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|