C16H10BrFN2O3 — CID 8986989
[2-(2-cyanoanilino)-2-oxoethyl] 2-bromo-5-fluorobenzoate (PubChem CID 8986989) has the molecular formula C16H10BrFN2O3 and a molecular weight of 377.17 g/mol. Its IUPAC name is [2-(2-cyanoanilino)-2-oxoethyl] 2-bromo-5-fluorobenzoate.
| Compound Name | [2-(2-cyanoanilino)-2-oxoethyl] 2-bromo-5-fluorobenzoate |
|---|---|
| PubChem CID | 8986989 |
| Molecular Formula | C16H10BrFN2O3 |
| Molecular Weight | 377.17 g/mol |
| Exact Mass | 375.99 |
| IUPAC Name | [2-(2-cyanoanilino)-2-oxoethyl] 2-bromo-5-fluorobenzoate |
| SMILES | N#Cc1ccccc1NC(=O)COC(=O)c1cc(F)ccc1Br |
| InChI | InChI=1S/C16H10BrFN2O3/c17-13-6-5-11(18)7-12(13)16(22)23-9-15(21)20-14-4-2-1-3-10(14)8-19/h1-7H,9H2,(H,20,21) |
| InChIKey | ZFTRRPRAYPDZTP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.17 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |