C16H12BrFN2O5 — CID 8987122
[2-(2-methyl-5-nitroanilino)-2-oxoethyl] 2-bromo-5-fluorobenzoate (PubChem CID 8987122) has the molecular formula C16H12BrFN2O5 and a molecular weight of 411.18 g/mol. Its IUPAC name is [2-(2-methyl-5-nitroanilino)-2-oxoethyl] 2-bromo-5-fluorobenzoate.
| Compound Name | [2-(2-methyl-5-nitroanilino)-2-oxoethyl] 2-bromo-5-fluorobenzoate |
|---|---|
| PubChem CID | 8987122 |
| Molecular Formula | C16H12BrFN2O5 |
| Molecular Weight | 411.18 g/mol |
| Exact Mass | 409.99 |
| IUPAC Name | [2-(2-methyl-5-nitroanilino)-2-oxoethyl] 2-bromo-5-fluorobenzoate |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NC(=O)COC(=O)c1cc(F)ccc1Br |
| InChI | InChI=1S/C16H12BrFN2O5/c1-9-2-4-11(20(23)24)7-14(9)19-15(21)8-25-16(22)12-6-10(18)3-5-13(12)17/h2-7H,8H2,1H3,(H,19,21) |
| InChIKey | UQZOHNGJBOUVLN-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.18 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|