C16H13N3O7 — CID 7864340
[2-(2-methyl-5-nitroanilino)-2-oxoethyl] 2-nitrobenzoate (PubChem CID 7864340) has the molecular formula C16H13N3O7 and a molecular weight of 359.29 g/mol. Its IUPAC name is [2-(2-methyl-5-nitroanilino)-2-oxoethyl] 2-nitrobenzoate.
| Compound Name | [2-(2-methyl-5-nitroanilino)-2-oxoethyl] 2-nitrobenzoate |
|---|---|
| PubChem CID | 7864340 |
| Molecular Formula | C16H13N3O7 |
| Molecular Weight | 359.29 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | [2-(2-methyl-5-nitroanilino)-2-oxoethyl] 2-nitrobenzoate |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NC(=O)COC(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H13N3O7/c1-10-6-7-11(18(22)23)8-13(10)17-15(20)9-26-16(21)12-4-2-3-5-14(12)19(24)25/h2-8H,9H2,1H3,(H,17,20) |
| InChIKey | TZEJEVWOOWCRDR-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 141.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.29 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|