C17H16N2O6 — CID 7861707
[2-(2-methyl-5-nitroanilino)-2-oxoethyl] 4-methoxybenzoate (PubChem CID 7861707) has the molecular formula C17H16N2O6 and a molecular weight of 344.32 g/mol. Its IUPAC name is [2-(2-methyl-5-nitroanilino)-2-oxoethyl] 4-methoxybenzoate.
| Compound Name | [2-(2-methyl-5-nitroanilino)-2-oxoethyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 7861707 |
| Molecular Formula | C17H16N2O6 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | [2-(2-methyl-5-nitroanilino)-2-oxoethyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)Nc2cc([N+](=O)[O-])ccc2C)cc1 |
| InChI | InChI=1S/C17H16N2O6/c1-11-3-6-13(19(22)23)9-15(11)18-16(20)10-25-17(21)12-4-7-14(24-2)8-5-12/h3-9H,10H2,1-2H3,(H,18,20) |
| InChIKey | XJMBBLXOCSOHJM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|