C17H15N3O7 — CID 4856935
[2-(4,5-dimethyl-2-nitroanilino)-2-oxoethyl] 4-nitrobenzoate (PubChem CID 4856935) has the molecular formula C17H15N3O7 and a molecular weight of 373.32 g/mol. Its IUPAC name is [2-(4,5-dimethyl-2-nitroanilino)-2-oxoethyl] 4-nitrobenzoate.
| Compound Name | [2-(4,5-dimethyl-2-nitroanilino)-2-oxoethyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 4856935 |
| Molecular Formula | C17H15N3O7 |
| Molecular Weight | 373.32 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | [2-(4,5-dimethyl-2-nitroanilino)-2-oxoethyl] 4-nitrobenzoate |
| SMILES | Cc1cc(NC(=O)COC(=O)c2ccc([N+](=O)[O-])cc2)c([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C17H15N3O7/c1-10-7-14(15(20(25)26)8-11(10)2)18-16(21)9-27-17(22)12-3-5-13(6-4-12)19(23)24/h3-8H,9H2,1-2H3,(H,18,21) |
| InChIKey | FLOKJEUITWSCLI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 141.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.32 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|