C15H9Cl3N2O5 — CID 7834952
[2-oxo-2-(2,4,5-trichloroanilino)ethyl] 4-nitrobenzoate (PubChem CID 7834952) has the molecular formula C15H9Cl3N2O5 and a molecular weight of 403.61 g/mol. Its IUPAC name is [2-oxo-2-(2,4,5-trichloroanilino)ethyl] 4-nitrobenzoate.
| Compound Name | [2-oxo-2-(2,4,5-trichloroanilino)ethyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 7834952 |
| Molecular Formula | C15H9Cl3N2O5 |
| Molecular Weight | 403.61 g/mol |
| Exact Mass | 401.96 |
| IUPAC Name | [2-oxo-2-(2,4,5-trichloroanilino)ethyl] 4-nitrobenzoate |
| SMILES | O=C(COC(=O)c1ccc([N+](=O)[O-])cc1)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H9Cl3N2O5/c16-10-5-12(18)13(6-11(10)17)19-14(21)7-25-15(22)8-1-3-9(4-2-8)20(23)24/h1-6H,7H2,(H,19,21) |
| InChIKey | ZCUNMSOEKTXARV-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.61 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|