C16H12Cl3N3O4 — CID 2527840
[2-oxo-2-(2,4,5-trichloroanilino)ethyl] 4-(carbamoylamino)benzoate (PubChem CID 2527840) has the molecular formula C16H12Cl3N3O4 and a molecular weight of 416.65 g/mol. Its IUPAC name is [2-oxo-2-(2,4,5-trichloroanilino)ethyl] 4-(carbamoylamino)benzoate.
| Compound Name | [2-oxo-2-(2,4,5-trichloroanilino)ethyl] 4-(carbamoylamino)benzoate |
|---|---|
| PubChem CID | 2527840 |
| Molecular Formula | C16H12Cl3N3O4 |
| Molecular Weight | 416.65 g/mol |
| Exact Mass | 414.99 |
| IUPAC Name | [2-oxo-2-(2,4,5-trichloroanilino)ethyl] 4-(carbamoylamino)benzoate |
| SMILES | NC(=O)Nc1ccc(C(=O)OCC(=O)Nc2cc(Cl)c(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C16H12Cl3N3O4/c17-10-5-12(19)13(6-11(10)18)22-14(23)7-26-15(24)8-1-3-9(4-2-8)21-16(20)25/h1-6H,7H2,(H,22,23)(H3,20,21,25) |
| InChIKey | NTJYLHFBRUWJFI-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.65 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|