C16H13ClN2O5 — CID 23887618
5-[[2-(4-aminobenzoyl)oxyacetyl]amino]-2-chlorobenzoic acid (PubChem CID 23887618) has the molecular formula C16H13ClN2O5 and a molecular weight of 348.74 g/mol. Its IUPAC name is 5-[[2-(4-aminobenzoyl)oxyacetyl]amino]-2-chlorobenzoic acid.
| Compound Name | 5-[[2-(4-aminobenzoyl)oxyacetyl]amino]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 23887618 |
| Molecular Formula | C16H13ClN2O5 |
| Molecular Weight | 348.74 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | 5-[[2-(4-aminobenzoyl)oxyacetyl]amino]-2-chlorobenzoic acid |
| SMILES | Nc1ccc(C(=O)OCC(=O)Nc2ccc(Cl)c(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C16H13ClN2O5/c17-13-6-5-11(7-12(13)15(21)22)19-14(20)8-24-16(23)9-1-3-10(18)4-2-9/h1-7H,8,18H2,(H,19,20)(H,21,22) |
| InChIKey | VRQOIVQHHLTLHP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.74 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|