C15H12BrClN2O3 — CID 2571645
[2-(4-bromoanilino)-2-oxoethyl] 3-amino-4-chlorobenzoate (PubChem CID 2571645) has the molecular formula C15H12BrClN2O3 and a molecular weight of 383.63 g/mol. Its IUPAC name is [2-(4-bromoanilino)-2-oxoethyl] 3-amino-4-chlorobenzoate.
| Compound Name | [2-(4-bromoanilino)-2-oxoethyl] 3-amino-4-chlorobenzoate |
|---|---|
| PubChem CID | 2571645 |
| Molecular Formula | C15H12BrClN2O3 |
| Molecular Weight | 383.63 g/mol |
| Exact Mass | 381.97 |
| IUPAC Name | [2-(4-bromoanilino)-2-oxoethyl] 3-amino-4-chlorobenzoate |
| SMILES | Nc1cc(C(=O)OCC(=O)Nc2ccc(Br)cc2)ccc1Cl |
| InChI | InChI=1S/C15H12BrClN2O3/c16-10-2-4-11(5-3-10)19-14(20)8-22-15(21)9-1-6-12(17)13(18)7-9/h1-7H,8,18H2,(H,19,20) |
| InChIKey | KSCHSLAOYJGBGU-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.63 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|