C18H18ClN3O4 — CID 9079069
[2-[3-(ethylcarbamoyl)anilino]-2-oxoethyl] 3-amino-4-chlorobenzoate (PubChem CID 9079069) has the molecular formula C18H18ClN3O4 and a molecular weight of 375.81 g/mol. Its IUPAC name is [2-[3-(ethylcarbamoyl)anilino]-2-oxoethyl] 3-amino-4-chlorobenzoate.
| Compound Name | [2-[3-(ethylcarbamoyl)anilino]-2-oxoethyl] 3-amino-4-chlorobenzoate |
|---|---|
| PubChem CID | 9079069 |
| Molecular Formula | C18H18ClN3O4 |
| Molecular Weight | 375.81 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | [2-[3-(ethylcarbamoyl)anilino]-2-oxoethyl] 3-amino-4-chlorobenzoate |
| SMILES | CCNC(=O)c1cccc(NC(=O)COC(=O)c2ccc(Cl)c(N)c2)c1 |
| InChI | InChI=1S/C18H18ClN3O4/c1-2-21-17(24)11-4-3-5-13(8-11)22-16(23)10-26-18(25)12-6-7-14(19)15(20)9-12/h3-9H,2,10,20H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | GGOUAFVBUINMBK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.81 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|