C24H29N3O6S — CID 55398874
[2-[3-(ethylcarbamoyl)anilino]-2-oxoethyl] 4-(azepan-1-ylsulfonyl)benzoate (PubChem CID 55398874) has the molecular formula C24H29N3O6S and a molecular weight of 487.58 g/mol. Its IUPAC name is [2-[3-(ethylcarbamoyl)anilino]-2-oxoethyl] 4-(azepan-1-ylsulfonyl)benzoate.
| Compound Name | [2-[3-(ethylcarbamoyl)anilino]-2-oxoethyl] 4-(azepan-1-ylsulfonyl)benzoate |
|---|---|
| PubChem CID | 55398874 |
| Molecular Formula | C24H29N3O6S |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | [2-[3-(ethylcarbamoyl)anilino]-2-oxoethyl] 4-(azepan-1-ylsulfonyl)benzoate |
| SMILES | CCNC(=O)c1cccc(NC(=O)COC(=O)c2ccc(S(=O)(=O)N3CCCCCC3)cc2)c1 |
| InChI | InChI=1S/C24H29N3O6S/c1-2-25-23(29)19-8-7-9-20(16-19)26-22(28)17-33-24(30)18-10-12-21(13-11-18)34(31,32)27-14-5-3-4-6-15-27/h7-13,16H,2-6,14-15,17H2,1H3,(H,25,29)(H,26,28) |
| InChIKey | JVMCDUQZBJOQJT-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |