C21H23N3O7S — CID 71904990
[2-[3-(azepan-1-ylsulfonyl)anilino]-2-oxoethyl] 4-nitrobenzoate (PubChem CID 71904990) has the molecular formula C21H23N3O7S and a molecular weight of 461.50 g/mol. Its IUPAC name is [2-[3-(azepan-1-ylsulfonyl)anilino]-2-oxoethyl] 4-nitrobenzoate.
| Compound Name | [2-[3-(azepan-1-ylsulfonyl)anilino]-2-oxoethyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 71904990 |
| Molecular Formula | C21H23N3O7S |
| Molecular Weight | 461.50 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | [2-[3-(azepan-1-ylsulfonyl)anilino]-2-oxoethyl] 4-nitrobenzoate |
| SMILES | O=C(COC(=O)c1ccc([N+](=O)[O-])cc1)Nc1cccc(S(=O)(=O)N2CCCCCC2)c1 |
| InChI | InChI=1S/C21H23N3O7S/c25-20(15-31-21(26)16-8-10-18(11-9-16)24(27)28)22-17-6-5-7-19(14-17)32(29,30)23-12-3-1-2-4-13-23/h5-11,14H,1-4,12-13,15H2,(H,22,25) |
| InChIKey | YBFHNYNNRZXQTB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.50 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|