C19H19FN2O5S — CID 2553567
[2-(3-fluoroanilino)-2-oxoethyl] 4-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 2553567) has the molecular formula C19H19FN2O5S and a molecular weight of 406.44 g/mol. Its IUPAC name is [2-(3-fluoroanilino)-2-oxoethyl] 4-pyrrolidin-1-ylsulfonylbenzoate.
| Compound Name | [2-(3-fluoroanilino)-2-oxoethyl] 4-pyrrolidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 2553567 |
| Molecular Formula | C19H19FN2O5S |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | [2-(3-fluoroanilino)-2-oxoethyl] 4-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | O=C(COC(=O)c1ccc(S(=O)(=O)N2CCCC2)cc1)Nc1cccc(F)c1 |
| InChI | InChI=1S/C19H19FN2O5S/c20-15-4-3-5-16(12-15)21-18(23)13-27-19(24)14-6-8-17(9-7-14)28(25,26)22-10-1-2-11-22/h3-9,12H,1-2,10-11,13H2,(H,21,23) |
| InChIKey | LQHQDGWENPBIQL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |