C23H25FN2O5S — CID 16509091
[2-(3-fluoroanilino)-2-oxoethyl] (E)-3-[4-(azepan-1-ylsulfonyl)phenyl]prop-2-enoate (PubChem CID 16509091) has the molecular formula C23H25FN2O5S and a molecular weight of 460.53 g/mol. Its IUPAC name is [2-(3-fluoroanilino)-2-oxoethyl] (E)-3-[4-(azepan-1-ylsulfonyl)phenyl]prop-2-enoate.
| Compound Name | [2-(3-fluoroanilino)-2-oxoethyl] (E)-3-[4-(azepan-1-ylsulfonyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 16509091 |
| Molecular Formula | C23H25FN2O5S |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | [2-(3-fluoroanilino)-2-oxoethyl] (E)-3-[4-(azepan-1-ylsulfonyl)phenyl]prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1ccc(S(=O)(=O)N2CCCCCC2)cc1)Nc1cccc(F)c1 |
| InChI | InChI=1S/C23H25FN2O5S/c24-19-6-5-7-20(16-19)25-22(27)17-31-23(28)13-10-18-8-11-21(12-9-18)32(29,30)26-14-3-1-2-4-15-26/h5-13,16H,1-4,14-15,17H2,(H,25,27)/b13-10+ |
| InChIKey | QFLFILJYWOWLQW-JLHYYAGUSA-N |
| XLogP | 3.59 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|