C26H30ClN3O8S2 — CID 6027216
[2-(2-chloro-5-piperidin-1-ylsulfonylanilino)-2-oxoethyl] (E)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoate (PubChem CID 6027216) has the molecular formula C26H30ClN3O8S2 and a molecular weight of 612.13 g/mol. Its IUPAC name is [2-(2-chloro-5-piperidin-1-ylsulfonylanilino)-2-oxoethyl] (E)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoate.
| Compound Name | [2-(2-chloro-5-piperidin-1-ylsulfonylanilino)-2-oxoethyl] (E)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 6027216 |
| Molecular Formula | C26H30ClN3O8S2 |
| Molecular Weight | 612.13 g/mol |
| Exact Mass | 611.12 |
| IUPAC Name | [2-(2-chloro-5-piperidin-1-ylsulfonylanilino)-2-oxoethyl] (E)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1ccc(S(=O)(=O)N2CCOCC2)cc1)Nc1cc(S(=O)(=O)N2CCCCC2)ccc1Cl |
| InChI | InChI=1S/C26H30ClN3O8S2/c27-23-10-9-22(40(35,36)29-12-2-1-3-13-29)18-24(23)28-25(31)19-38-26(32)11-6-20-4-7-21(8-5-20)39(33,34)30-14-16-37-17-15-30/h4-11,18H,1-3,12-17,19H2,(H,28,31)/b11-6+ |
| InChIKey | KSJRKCASLLOXDF-IZZDOVSWSA-N |
| XLogP | 2.73 |
| TPSA | 139.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.13 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|