C22H21F3N2O6S — CID 4232932
[2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] 3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoate (PubChem CID 4232932) has the molecular formula C22H21F3N2O6S and a molecular weight of 498.48 g/mol. Its IUPAC name is [2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] 3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoate.
| Compound Name | [2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] 3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 4232932 |
| Molecular Formula | C22H21F3N2O6S |
| Molecular Weight | 498.48 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | [2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] 3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoate |
| SMILES | O=C(COC(=O)C=Cc1ccc(S(=O)(=O)N2CCOCC2)cc1)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H21F3N2O6S/c23-22(24,25)17-4-6-18(7-5-17)26-20(28)15-33-21(29)10-3-16-1-8-19(9-2-16)34(30,31)27-11-13-32-14-12-27/h1-10H,11-15H2,(H,26,28) |
| InChIKey | JZDADELBVMBLFI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.48 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|