C21H20Cl2N2O6S — CID 2357545
[2-(3,5-dichloroanilino)-2-oxoethyl] (E)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoate (PubChem CID 2357545) has the molecular formula C21H20Cl2N2O6S and a molecular weight of 499.37 g/mol. Its IUPAC name is [2-(3,5-dichloroanilino)-2-oxoethyl] (E)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoate.
| Compound Name | [2-(3,5-dichloroanilino)-2-oxoethyl] (E)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 2357545 |
| Molecular Formula | C21H20Cl2N2O6S |
| Molecular Weight | 499.37 g/mol |
| Exact Mass | 498.04 |
| IUPAC Name | [2-(3,5-dichloroanilino)-2-oxoethyl] (E)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1ccc(S(=O)(=O)N2CCOCC2)cc1)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C21H20Cl2N2O6S/c22-16-11-17(23)13-18(12-16)24-20(26)14-31-21(27)6-3-15-1-4-19(5-2-15)32(28,29)25-7-9-30-10-8-25/h1-6,11-13H,7-10,14H2,(H,24,26)/b6-3+ |
| InChIKey | UMNGWNGHENOXRW-ZZXKWVIFSA-N |
| XLogP | 3.21 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.37 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|