C21H20ClNO6S — CID 3508397
[2-(4-chlorophenyl)-2-oxoethyl] 3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoate (PubChem CID 3508397) has the molecular formula C21H20ClNO6S and a molecular weight of 449.91 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-2-oxoethyl] 3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoate.
| Compound Name | [2-(4-chlorophenyl)-2-oxoethyl] 3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 3508397 |
| Molecular Formula | C21H20ClNO6S |
| Molecular Weight | 449.91 g/mol |
| Exact Mass | 449.07 |
| IUPAC Name | [2-(4-chlorophenyl)-2-oxoethyl] 3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoate |
| SMILES | O=C(C=Cc1ccc(S(=O)(=O)N2CCOCC2)cc1)OCC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H20ClNO6S/c22-18-6-4-17(5-7-18)20(24)15-29-21(25)10-3-16-1-8-19(9-2-16)30(26,27)23-11-13-28-14-12-23/h1-10H,11-15H2 |
| InChIKey | QKQKXGPPZUYIAQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.91 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|