C23H25NO5S — CID 2078749
phenacyl (E)-3-[4-(azepan-1-ylsulfonyl)phenyl]prop-2-enoate (PubChem CID 2078749) has the molecular formula C23H25NO5S and a molecular weight of 427.52 g/mol. Its IUPAC name is phenacyl (E)-3-[4-(azepan-1-ylsulfonyl)phenyl]prop-2-enoate.
| Compound Name | phenacyl (E)-3-[4-(azepan-1-ylsulfonyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 2078749 |
| Molecular Formula | C23H25NO5S |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | phenacyl (E)-3-[4-(azepan-1-ylsulfonyl)phenyl]prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc(S(=O)(=O)N2CCCCCC2)cc1)OCC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H25NO5S/c25-22(20-8-4-3-5-9-20)18-29-23(26)15-12-19-10-13-21(14-11-19)30(27,28)24-16-6-1-2-7-17-24/h3-5,8-15H,1-2,6-7,16-18H2/b15-12+ |
| InChIKey | KNJAXMCSCFLLSX-NTCAYCPXSA-N |
| XLogP | 3.69 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|