C23H27NO4S — CID 71954495
(4-methylphenyl)methyl 3-[4-(azepan-1-ylsulfonyl)phenyl]prop-2-enoate (PubChem CID 71954495) has the molecular formula C23H27NO4S and a molecular weight of 413.54 g/mol. Its IUPAC name is (4-methylphenyl)methyl 3-[4-(azepan-1-ylsulfonyl)phenyl]prop-2-enoate.
| Compound Name | (4-methylphenyl)methyl 3-[4-(azepan-1-ylsulfonyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 71954495 |
| Molecular Formula | C23H27NO4S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | (4-methylphenyl)methyl 3-[4-(azepan-1-ylsulfonyl)phenyl]prop-2-enoate |
| SMILES | Cc1ccc(COC(=O)C=Cc2ccc(S(=O)(=O)N3CCCCCC3)cc2)cc1 |
| InChI | InChI=1S/C23H27NO4S/c1-19-6-8-21(9-7-19)18-28-23(25)15-12-20-10-13-22(14-11-20)29(26,27)24-16-4-2-3-5-17-24/h6-15H,2-5,16-18H2,1H3 |
| InChIKey | QDOSPWYUZQTQTA-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|