C22H23Cl2NO4S — CID 3642890
(2,4-dichlorophenyl)methyl 3-[4-(azepan-1-ylsulfonyl)phenyl]prop-2-enoate (PubChem CID 3642890) has the molecular formula C22H23Cl2NO4S and a molecular weight of 468.40 g/mol. Its IUPAC name is (2,4-dichlorophenyl)methyl 3-[4-(azepan-1-ylsulfonyl)phenyl]prop-2-enoate.
| Compound Name | (2,4-dichlorophenyl)methyl 3-[4-(azepan-1-ylsulfonyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 3642890 |
| Molecular Formula | C22H23Cl2NO4S |
| Molecular Weight | 468.40 g/mol |
| Exact Mass | 467.07 |
| IUPAC Name | (2,4-dichlorophenyl)methyl 3-[4-(azepan-1-ylsulfonyl)phenyl]prop-2-enoate |
| SMILES | O=C(C=Cc1ccc(S(=O)(=O)N2CCCCCC2)cc1)OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H23Cl2NO4S/c23-19-9-8-18(21(24)15-19)16-29-22(26)12-7-17-5-10-20(11-6-17)30(27,28)25-13-3-1-2-4-14-25/h5-12,15H,1-4,13-14,16H2 |
| InChIKey | FCQXBEJIMYTNTI-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.40 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|