C19H25NO6S — CID 16568764
methyl 2-[(E)-3-[4-(azepan-1-ylsulfonyl)phenyl]prop-2-enoyl]oxypropanoate (PubChem CID 16568764) has the molecular formula C19H25NO6S and a molecular weight of 395.48 g/mol. Its IUPAC name is methyl 2-[(E)-3-[4-(azepan-1-ylsulfonyl)phenyl]prop-2-enoyl]oxypropanoate.
| Compound Name | methyl 2-[(E)-3-[4-(azepan-1-ylsulfonyl)phenyl]prop-2-enoyl]oxypropanoate |
|---|---|
| PubChem CID | 16568764 |
| Molecular Formula | C19H25NO6S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | methyl 2-[(E)-3-[4-(azepan-1-ylsulfonyl)phenyl]prop-2-enoyl]oxypropanoate |
| SMILES | COC(=O)C(C)OC(=O)/C=C/c1ccc(S(=O)(=O)N2CCCCCC2)cc1 |
| InChI | InChI=1S/C19H25NO6S/c1-15(19(22)25-2)26-18(21)12-9-16-7-10-17(11-8-16)27(23,24)20-13-5-3-4-6-14-20/h7-12,15H,3-6,13-14H2,1-2H3/b12-9+ |
| InChIKey | IJPYGMUPUDAKSS-FMIVXFBMSA-N |
| XLogP | 2.37 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|