C17H21NO7S — CID 16568787
methyl 2-[(E)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoyl]oxypropanoate (PubChem CID 16568787) has the molecular formula C17H21NO7S and a molecular weight of 383.42 g/mol. Its IUPAC name is methyl 2-[(E)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoyl]oxypropanoate.
| Compound Name | methyl 2-[(E)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoyl]oxypropanoate |
|---|---|
| PubChem CID | 16568787 |
| Molecular Formula | C17H21NO7S |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | methyl 2-[(E)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoyl]oxypropanoate |
| SMILES | COC(=O)C(C)OC(=O)/C=C/c1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C17H21NO7S/c1-13(17(20)23-2)25-16(19)8-5-14-3-6-15(7-4-14)26(21,22)18-9-11-24-12-10-18/h3-8,13H,9-12H2,1-2H3/b8-5+ |
| InChIKey | CVVCGQDUNHLZES-VMPITWQZSA-N |
| XLogP | 0.83 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|