C14H19NO6S — CID 9331081
methyl (2S)-2-(4-morpholin-4-ylsulfonylphenoxy)propanoate (PubChem CID 9331081) has the molecular formula C14H19NO6S and a molecular weight of 329.37 g/mol. Its IUPAC name is methyl (2S)-2-(4-morpholin-4-ylsulfonylphenoxy)propanoate.
| Compound Name | methyl (2S)-2-(4-morpholin-4-ylsulfonylphenoxy)propanoate |
|---|---|
| PubChem CID | 9331081 |
| Molecular Formula | C14H19NO6S |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | methyl (2S)-2-(4-morpholin-4-ylsulfonylphenoxy)propanoate |
| SMILES | COC(=O)[C@H](C)Oc1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C14H19NO6S/c1-11(14(16)19-2)21-12-3-5-13(6-4-12)22(17,18)15-7-9-20-10-8-15/h3-6,11H,7-10H2,1-2H3/t11-/m0/s1 |
| InChIKey | ILJTWJDSEXPXOI-NSHDSACASA-N |
| XLogP | 0.65 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |