C22H23ClN2O6S — CID 3895054
[1-(4-morpholin-4-ylsulfonylanilino)-1-oxopropan-2-yl] 3-(2-chlorophenyl)prop-2-enoate (PubChem CID 3895054) has the molecular formula C22H23ClN2O6S and a molecular weight of 478.95 g/mol. Its IUPAC name is [1-(4-morpholin-4-ylsulfonylanilino)-1-oxopropan-2-yl] 3-(2-chlorophenyl)prop-2-enoate.
| Compound Name | [1-(4-morpholin-4-ylsulfonylanilino)-1-oxopropan-2-yl] 3-(2-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 3895054 |
| Molecular Formula | C22H23ClN2O6S |
| Molecular Weight | 478.95 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | [1-(4-morpholin-4-ylsulfonylanilino)-1-oxopropan-2-yl] 3-(2-chlorophenyl)prop-2-enoate |
| SMILES | CC(OC(=O)C=Cc1ccccc1Cl)C(=O)Nc1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C22H23ClN2O6S/c1-16(31-21(26)11-6-17-4-2-3-5-20(17)23)22(27)24-18-7-9-19(10-8-18)32(28,29)25-12-14-30-15-13-25/h2-11,16H,12-15H2,1H3,(H,24,27) |
| InChIKey | QODGLADCRSXRQD-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.95 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|