C20H18ClNO4 — CID 7786854
[(2R)-1-(4-acetylanilino)-1-oxopropan-2-yl] (E)-3-(2-chlorophenyl)prop-2-enoate (PubChem CID 7786854) has the molecular formula C20H18ClNO4 and a molecular weight of 371.82 g/mol. Its IUPAC name is [(2R)-1-(4-acetylanilino)-1-oxopropan-2-yl] (E)-3-(2-chlorophenyl)prop-2-enoate.
| Compound Name | [(2R)-1-(4-acetylanilino)-1-oxopropan-2-yl] (E)-3-(2-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7786854 |
| Molecular Formula | C20H18ClNO4 |
| Molecular Weight | 371.82 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | [(2R)-1-(4-acetylanilino)-1-oxopropan-2-yl] (E)-3-(2-chlorophenyl)prop-2-enoate |
| SMILES | CC(=O)c1ccc(NC(=O)[C@@H](C)OC(=O)/C=C/c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C20H18ClNO4/c1-13(23)15-7-10-17(11-8-15)22-20(25)14(2)26-19(24)12-9-16-5-3-4-6-18(16)21/h3-12,14H,1-2H3,(H,22,25)/b12-9+/t14-/m1/s1 |
| InChIKey | ACSFAWMTAAGUQH-BRADTZPFSA-N |
| XLogP | 4.13 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.82 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|