C19H17FN2O4 — CID 7970520
[(2S)-1-(4-carbamoylanilino)-1-oxopropan-2-yl] (E)-3-(2-fluorophenyl)prop-2-enoate (PubChem CID 7970520) has the molecular formula C19H17FN2O4 and a molecular weight of 356.35 g/mol. Its IUPAC name is [(2S)-1-(4-carbamoylanilino)-1-oxopropan-2-yl] (E)-3-(2-fluorophenyl)prop-2-enoate.
| Compound Name | [(2S)-1-(4-carbamoylanilino)-1-oxopropan-2-yl] (E)-3-(2-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7970520 |
| Molecular Formula | C19H17FN2O4 |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | [(2S)-1-(4-carbamoylanilino)-1-oxopropan-2-yl] (E)-3-(2-fluorophenyl)prop-2-enoate |
| SMILES | C[C@H](OC(=O)/C=C/c1ccccc1F)C(=O)Nc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C19H17FN2O4/c1-12(19(25)22-15-9-6-14(7-10-15)18(21)24)26-17(23)11-8-13-4-2-3-5-16(13)20/h2-12H,1H3,(H2,21,24)(H,22,25)/b11-8+/t12-/m0/s1 |
| InChIKey | HEUHJFYVLZDENR-OBIHZWKSSA-N |
| XLogP | 2.51 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|