C25H22FNO4 — CID 7485480
[(2R)-1-oxo-1-(4-phenylmethoxyanilino)propan-2-yl] (E)-3-(2-fluorophenyl)prop-2-enoate (PubChem CID 7485480) has the molecular formula C25H22FNO4 and a molecular weight of 419.45 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(4-phenylmethoxyanilino)propan-2-yl] (E)-3-(2-fluorophenyl)prop-2-enoate.
| Compound Name | [(2R)-1-oxo-1-(4-phenylmethoxyanilino)propan-2-yl] (E)-3-(2-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7485480 |
| Molecular Formula | C25H22FNO4 |
| Molecular Weight | 419.45 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | [(2R)-1-oxo-1-(4-phenylmethoxyanilino)propan-2-yl] (E)-3-(2-fluorophenyl)prop-2-enoate |
| SMILES | C[C@@H](OC(=O)/C=C/c1ccccc1F)C(=O)Nc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H22FNO4/c1-18(31-24(28)16-11-20-9-5-6-10-23(20)26)25(29)27-21-12-14-22(15-13-21)30-17-19-7-3-2-4-8-19/h2-16,18H,17H2,1H3,(H,27,29)/b16-11+/t18-/m1/s1 |
| InChIKey | CFZUNRJWUDKHDZ-QIPHDZALSA-N |
| XLogP | 4.99 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.45 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|