C22H25NO4 — CID 55365994
[1-oxo-1-(propan-2-ylamino)propan-2-yl] (E)-3-(4-phenylmethoxyphenyl)prop-2-enoate (PubChem CID 55365994) has the molecular formula C22H25NO4 and a molecular weight of 367.44 g/mol. Its IUPAC name is [1-oxo-1-(propan-2-ylamino)propan-2-yl] (E)-3-(4-phenylmethoxyphenyl)prop-2-enoate.
| Compound Name | [1-oxo-1-(propan-2-ylamino)propan-2-yl] (E)-3-(4-phenylmethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 55365994 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | [1-oxo-1-(propan-2-ylamino)propan-2-yl] (E)-3-(4-phenylmethoxyphenyl)prop-2-enoate |
| SMILES | CC(C)NC(=O)C(C)OC(=O)/C=C/c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C22H25NO4/c1-16(2)23-22(25)17(3)27-21(24)14-11-18-9-12-20(13-10-18)26-15-19-7-5-4-6-8-19/h4-14,16-17H,15H2,1-3H3,(H,23,25)/b14-11+ |
| InChIKey | XOAJMGQSNGPFCM-SDNWHVSQSA-N |
| XLogP | 3.74 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|