C23H21NO4S — CID 7550145
[(2S)-1-oxo-1-(4-phenylmethoxyanilino)propan-2-yl] (E)-3-thiophen-3-ylprop-2-enoate (PubChem CID 7550145) has the molecular formula C23H21NO4S and a molecular weight of 407.49 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(4-phenylmethoxyanilino)propan-2-yl] (E)-3-thiophen-3-ylprop-2-enoate.
| Compound Name | [(2S)-1-oxo-1-(4-phenylmethoxyanilino)propan-2-yl] (E)-3-thiophen-3-ylprop-2-enoate |
|---|---|
| PubChem CID | 7550145 |
| Molecular Formula | C23H21NO4S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | [(2S)-1-oxo-1-(4-phenylmethoxyanilino)propan-2-yl] (E)-3-thiophen-3-ylprop-2-enoate |
| SMILES | C[C@H](OC(=O)/C=C/c1ccsc1)C(=O)Nc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H21NO4S/c1-17(28-22(25)12-7-19-13-14-29-16-19)23(26)24-20-8-10-21(11-9-20)27-15-18-5-3-2-4-6-18/h2-14,16-17H,15H2,1H3,(H,24,26)/b12-7+/t17-/m0/s1 |
| InChIKey | CFQIAXANPVMFGO-CRVDFBCUSA-N |
| XLogP | 4.91 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|