C17H16ClNO4S — CID 8976027
[(2R)-1-(3-chloro-4-methoxyanilino)-1-oxopropan-2-yl] (E)-3-thiophen-3-ylprop-2-enoate (PubChem CID 8976027) has the molecular formula C17H16ClNO4S and a molecular weight of 365.84 g/mol. Its IUPAC name is [(2R)-1-(3-chloro-4-methoxyanilino)-1-oxopropan-2-yl] (E)-3-thiophen-3-ylprop-2-enoate.
| Compound Name | [(2R)-1-(3-chloro-4-methoxyanilino)-1-oxopropan-2-yl] (E)-3-thiophen-3-ylprop-2-enoate |
|---|---|
| PubChem CID | 8976027 |
| Molecular Formula | C17H16ClNO4S |
| Molecular Weight | 365.84 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | [(2R)-1-(3-chloro-4-methoxyanilino)-1-oxopropan-2-yl] (E)-3-thiophen-3-ylprop-2-enoate |
| SMILES | COc1ccc(NC(=O)[C@@H](C)OC(=O)/C=C/c2ccsc2)cc1Cl |
| InChI | InChI=1S/C17H16ClNO4S/c1-11(23-16(20)6-3-12-7-8-24-10-12)17(21)19-13-4-5-15(22-2)14(18)9-13/h3-11H,1-2H3,(H,19,21)/b6-3+/t11-/m1/s1 |
| InChIKey | AXXZUSHDGDPVDE-ZXCPCRMDSA-N |
| XLogP | 3.99 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.84 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|