C18H17NO5S — CID 7550111
[(2S)-1-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-1-oxopropan-2-yl] (E)-3-thiophen-3-ylprop-2-enoate (PubChem CID 7550111) has the molecular formula C18H17NO5S and a molecular weight of 359.40 g/mol. Its IUPAC name is [(2S)-1-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-1-oxopropan-2-yl] (E)-3-thiophen-3-ylprop-2-enoate.
| Compound Name | [(2S)-1-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-1-oxopropan-2-yl] (E)-3-thiophen-3-ylprop-2-enoate |
|---|---|
| PubChem CID | 7550111 |
| Molecular Formula | C18H17NO5S |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | [(2S)-1-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-1-oxopropan-2-yl] (E)-3-thiophen-3-ylprop-2-enoate |
| SMILES | C[C@H](OC(=O)/C=C/c1ccsc1)C(=O)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C18H17NO5S/c1-12(24-17(20)5-2-13-6-9-25-11-13)18(21)19-14-3-4-15-16(10-14)23-8-7-22-15/h2-6,9-12H,7-8H2,1H3,(H,19,21)/b5-2+/t12-/m0/s1 |
| InChIKey | UXSPFKWRPWKCIX-PWFBRDGFSA-N |
| XLogP | 3.10 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|