C16H13Cl2NO3S — CID 55373299
[1-(2,5-dichloroanilino)-1-oxopropan-2-yl] (E)-3-thiophen-3-ylprop-2-enoate (PubChem CID 55373299) has the molecular formula C16H13Cl2NO3S and a molecular weight of 370.26 g/mol. Its IUPAC name is [1-(2,5-dichloroanilino)-1-oxopropan-2-yl] (E)-3-thiophen-3-ylprop-2-enoate.
| Compound Name | [1-(2,5-dichloroanilino)-1-oxopropan-2-yl] (E)-3-thiophen-3-ylprop-2-enoate |
|---|---|
| PubChem CID | 55373299 |
| Molecular Formula | C16H13Cl2NO3S |
| Molecular Weight | 370.26 g/mol |
| Exact Mass | 369.00 |
| IUPAC Name | [1-(2,5-dichloroanilino)-1-oxopropan-2-yl] (E)-3-thiophen-3-ylprop-2-enoate |
| SMILES | CC(OC(=O)/C=C/c1ccsc1)C(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H13Cl2NO3S/c1-10(22-15(20)5-2-11-6-7-23-9-11)16(21)19-14-8-12(17)3-4-13(14)18/h2-10H,1H3,(H,19,21)/b5-2+ |
| InChIKey | FUBLOFAUTIPUOI-GORDUTHDSA-N |
| XLogP | 4.64 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.26 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|