C26H24ClNO5 — CID 4252952
[1-(2-methoxyanilino)-1-oxopropan-2-yl] 3-[4-[(4-chlorophenyl)methoxy]phenyl]prop-2-enoate (PubChem CID 4252952) has the molecular formula C26H24ClNO5 and a molecular weight of 465.93 g/mol. Its IUPAC name is [1-(2-methoxyanilino)-1-oxopropan-2-yl] 3-[4-[(4-chlorophenyl)methoxy]phenyl]prop-2-enoate.
| Compound Name | [1-(2-methoxyanilino)-1-oxopropan-2-yl] 3-[4-[(4-chlorophenyl)methoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 4252952 |
| Molecular Formula | C26H24ClNO5 |
| Molecular Weight | 465.93 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | [1-(2-methoxyanilino)-1-oxopropan-2-yl] 3-[4-[(4-chlorophenyl)methoxy]phenyl]prop-2-enoate |
| SMILES | COc1ccccc1NC(=O)C(C)OC(=O)C=Cc1ccc(OCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C26H24ClNO5/c1-18(26(30)28-23-5-3-4-6-24(23)31-2)33-25(29)16-11-19-9-14-22(15-10-19)32-17-20-7-12-21(27)13-8-20/h3-16,18H,17H2,1-2H3,(H,28,30) |
| InChIKey | UKDQOKRUQNOWRA-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.93 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|