C25H24N2O5 — CID 55994306
[1-(2-methoxyanilino)-1-oxopropan-2-yl] 3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-enoate (PubChem CID 55994306) has the molecular formula C25H24N2O5 and a molecular weight of 432.48 g/mol. Its IUPAC name is [1-(2-methoxyanilino)-1-oxopropan-2-yl] 3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-enoate.
| Compound Name | [1-(2-methoxyanilino)-1-oxopropan-2-yl] 3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 55994306 |
| Molecular Formula | C25H24N2O5 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | [1-(2-methoxyanilino)-1-oxopropan-2-yl] 3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-enoate |
| SMILES | COc1ccccc1NC(=O)C(C)OC(=O)C=Cc1ccc(OCc2ccccn2)cc1 |
| InChI | InChI=1S/C25H24N2O5/c1-18(25(29)27-22-8-3-4-9-23(22)30-2)32-24(28)15-12-19-10-13-21(14-11-19)31-17-20-7-5-6-16-26-20/h3-16,18H,17H2,1-2H3,(H,27,29) |
| InChIKey | YJCOLQUTKLRSSE-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|