C22H26N2O4 — CID 55737662
[1-(2-methylpropylamino)-1-oxopropan-2-yl] (E)-3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-enoate (PubChem CID 55737662) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is [1-(2-methylpropylamino)-1-oxopropan-2-yl] (E)-3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-enoate.
| Compound Name | [1-(2-methylpropylamino)-1-oxopropan-2-yl] (E)-3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 55737662 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | [1-(2-methylpropylamino)-1-oxopropan-2-yl] (E)-3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-enoate |
| SMILES | CC(C)CNC(=O)C(C)OC(=O)/C=C/c1ccc(OCc2ccccn2)cc1 |
| InChI | InChI=1S/C22H26N2O4/c1-16(2)14-24-22(26)17(3)28-21(25)12-9-18-7-10-20(11-8-18)27-15-19-6-4-5-13-23-19/h4-13,16-17H,14-15H2,1-3H3,(H,24,26)/b12-9+ |
| InChIKey | KEBCIOBGXQDUGV-FMIVXFBMSA-N |
| XLogP | 3.38 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|