C25H25N3O3 — CID 55864279
N-propan-2-yl-4-[3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-enoylamino]benzamide (PubChem CID 55864279) has the molecular formula C25H25N3O3 and a molecular weight of 415.49 g/mol. Its IUPAC name is N-propan-2-yl-4-[3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-enoylamino]benzamide.
| Compound Name | N-propan-2-yl-4-[3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-enoylamino]benzamide |
|---|---|
| PubChem CID | 55864279 |
| Molecular Formula | C25H25N3O3 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | N-propan-2-yl-4-[3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-enoylamino]benzamide |
| SMILES | CC(C)NC(=O)c1ccc(NC(=O)C=Cc2ccc(OCc3ccccn3)cc2)cc1 |
| InChI | InChI=1S/C25H25N3O3/c1-18(2)27-25(30)20-9-11-21(12-10-20)28-24(29)15-8-19-6-13-23(14-7-19)31-17-22-5-3-4-16-26-22/h3-16,18H,17H2,1-2H3,(H,27,30)(H,28,29) |
| InChIKey | DBOCXVIULWOSTP-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|