C25H26N2O3 — CID 86941732
(E)-N-[1-(3-methoxyphenyl)propan-2-yl]-3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-enamide (PubChem CID 86941732) has the molecular formula C25H26N2O3 and a molecular weight of 402.49 g/mol. Its IUPAC name is (E)-N-[1-(3-methoxyphenyl)propan-2-yl]-3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[1-(3-methoxyphenyl)propan-2-yl]-3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 86941732 |
| Molecular Formula | C25H26N2O3 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | (E)-N-[1-(3-methoxyphenyl)propan-2-yl]-3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-enamide |
| SMILES | COc1cccc(CC(C)NC(=O)/C=C/c2ccc(OCc3ccccn3)cc2)c1 |
| InChI | InChI=1S/C25H26N2O3/c1-19(16-21-6-5-8-24(17-21)29-2)27-25(28)14-11-20-9-12-23(13-10-20)30-18-22-7-3-4-15-26-22/h3-15,17,19H,16,18H2,1-2H3,(H,27,28)/b14-11+ |
| InChIKey | IYVUQYMEURUVOH-SDNWHVSQSA-N |
| XLogP | 4.43 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|