C25H26N2O5 — CID 46575969
(E)-3-[4-(pyridin-2-ylmethoxy)phenyl]-N-[(3,4,5-trimethoxyphenyl)methyl]prop-2-enamide (PubChem CID 46575969) has the molecular formula C25H26N2O5 and a molecular weight of 434.49 g/mol. Its IUPAC name is (E)-3-[4-(pyridin-2-ylmethoxy)phenyl]-N-[(3,4,5-trimethoxyphenyl)methyl]prop-2-enamide.
| Compound Name | (E)-3-[4-(pyridin-2-ylmethoxy)phenyl]-N-[(3,4,5-trimethoxyphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 46575969 |
| Molecular Formula | C25H26N2O5 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | (E)-3-[4-(pyridin-2-ylmethoxy)phenyl]-N-[(3,4,5-trimethoxyphenyl)methyl]prop-2-enamide |
| SMILES | COc1cc(CNC(=O)/C=C/c2ccc(OCc3ccccn3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C25H26N2O5/c1-29-22-14-19(15-23(30-2)25(22)31-3)16-27-24(28)12-9-18-7-10-21(11-8-18)32-17-20-6-4-5-13-26-20/h4-15H,16-17H2,1-3H3,(H,27,28)/b12-9+ |
| InChIKey | BNWDBWGWFAZGIM-FMIVXFBMSA-N |
| XLogP | 4.02 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|