C21H26N2O3 — CID 75433996
(E)-N-[3-(hydroxymethyl)pentan-3-yl]-3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-enamide (PubChem CID 75433996) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is (E)-N-[3-(hydroxymethyl)pentan-3-yl]-3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[3-(hydroxymethyl)pentan-3-yl]-3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 75433996 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | (E)-N-[3-(hydroxymethyl)pentan-3-yl]-3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-enamide |
| SMILES | CCC(CC)(CO)NC(=O)/C=C/c1ccc(OCc2ccccn2)cc1 |
| InChI | InChI=1S/C21H26N2O3/c1-3-21(4-2,16-24)23-20(25)13-10-17-8-11-19(12-9-17)26-15-18-7-5-6-14-22-18/h5-14,24H,3-4,15-16H2,1-2H3,(H,23,25)/b13-10+ |
| InChIKey | NRLLWJNHFFCLAW-JLHYYAGUSA-N |
| XLogP | 3.34 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|